Which of the following molecular formulas corresponds to a degree of unsaturation of 5?

A $C X_{8} H X_{11} N$
B $C X_{6} H X_{8} N X_{2}$
C $C X_{7} H X_{7} Cl$
D $C X_{7} H X_{5} ClO$

Answer: D

Use DU = (2C + 2 + N - H - X)/2; oxygen is ignored. C7H5ClO: (14 + 2 - 5 - 1)/2 = 5. C7H7Cl: (14 + 2 - 7 - 1)/2 = 4. C6H8N2: (12 + 2 + 2 - 8)/2 = 4. C8H11N: (16 + 2 + 1 - 11)/2 = 4. Only C7H5ClO gives 5.

Practice IUPAC Nomenclature and Structural Isomerism More on Classification and degree of unsaturation

Previous questionNext question

More questions on Classification and degree of unsaturation

A quaternary carbon is a carbon bonded to four other carbon atoms. Which of the following alkanes contains one? NEET level
How many primary, secondary and tertiary carbon atoms, respectively, are present in CH3-CH(CH3)-CH(CH2-CH3)-CH2-CH2-CH3? JEE Main level
In (CH3)3C-CH(CH3)-CH2-CH3, what is the ratio of the number of primary : secondary : tertiary hydrogen atoms? JEE Main level
Calculate the degree of unsaturation (number of rings plus pi bonds) of a compound of molecular formula C10H11ClN2O2. Give the answer as an ... JEE Main level
What is the degree of unsaturation of 4-ethenylcyclohexene? JEE Main level
Which of the following is NOT an aromatic compound? JEE Main level